Introduction:Basic information about Olivil CAS 2955-23-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Olivil Basic information
| Product Name: | Olivil |
| Synonyms: | (-)-Olivil;(2S)-Tetrahydro-4α-hydroxy-2α-(4-hydroxy-3-methoxyphenyl)-4-[(4-hydroxy-3-methoxyphenyl)methyl]-3β-furanmethanol;2-Methoxy-4-[[(2S)-3β-(hydroxymethyl)-4α-hydroxy-4-(3-methoxy-4-hydroxybenzyl)tetrahydrofuran]-2α-yl]phenol;Olivil;Vladinol C;3-Furanmethanol,tetrahydro-4-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-4-[(4-hydroxy-3-methoxyphenyl)methyl]-,(2S,3R,4S)-;(3S,4R,5S)-3-(4-Hydroxy-3-methoxybenzyl)-5-(4-hydroxy-3-methoxyphenyl)-4-(hydroxymethyl)tetrahydro-3-furanol;(-)-Olivil / |
| CAS: | 2955-23-9 |
| MF: | C20H24O7 |
| MW: | 376.4 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 2955-23-9.mol |
|
Olivil Chemical Properties
| Melting point | 142.5 °C |
| Boiling point | 619.3±55.0 °C(Predicted) |
| density | 1.339±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in chloroform and DMSO |
| form | powder |
| pka | 9.91±0.35(Predicted) |
| color | White-grey |
| InChI | 1S/C20H24O7/c1-25-17-7-12(3-5-15(17)22)9-20(24)11-27-19(14(20)10-21)13-4-6-16(23)18(8-13)26-2/h3-8,14,19,21-24H,9-11H2,1-2H3/t14-,19-,20-/m1/s1 |
| InChIKey | BVHIKUCXNBQDEM-JSNMRZPZSA-N |
| SMILES | OC[C@@H]([C@](CC1=CC=C(O)C(OC)=C1)(O)CO2)[C@H]2C3=CC=C(O)C(OC)=C3 |
Safety Information
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
Olivil Usage And Synthesis
| Uses | Olivil ((-)-Olivile) is a lignan that has weak DPPH radical-scavenging activity (EC50: 176 μM)[1]. |
| References | [1] Pérez-Bonilla M, et al. Radical-scavenging compounds from olive tree (Olea europaea L.) wood. J Agric Food Chem. 2014 Jan 8;62(1):144-51. DOI:10.1021/jf403998t |
Olivil Preparation Products And Raw materials