Introduction：Basic information about PENTAMETHOXY RED CAS 1755-51-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
PENTAMETHOXY RED Basic information
| Product Name: | PENTAMETHOXY RED |
| Synonyms: | Pentamethoxylred;PENTAMETHOXY RED;BIS(2,4-DIMETHOXYPHENYL)(2-METHOXYPHENYL)METHANOL;2,2',2'',4,4'-PENTAMETHOXYTRIPHENYLMETHANOL;2,2',2'',4,4'-pentamethoxytrityl alcohol;2,2',2",4,4'-Pentamethoxytriphenylcarbinol;Benzenemethanol, .alpha.-(2,4-dimethoxyphenyl)-2,4-dimethoxy-.alpha.-(2-methoxyphenyl)-;α-(2,4-Dimethoxyphenyl)-2,4-dimethoxy-α-(2-methoxyphenyl)benzenemethanol |
| CAS: | 1755-51-7 |
| MF: | C24H26O6 |
| MW: | 410.46 |
| EINECS: | 217-146-8 |
| Product Categories: | Analytical Chemistry;Indicator (pH);pH Indicators;Triphenylmethane |
| Mol File: | 1755-51-7.mol |
|
PENTAMETHOXY RED Chemical Properties
| Melting point | 146°C |
| solubility | Solubility Insoluble in water; soluble in ethanol |
| pka | 1.86(at 25℃) |
| form | crystals |
| color | White |
| PH Range | Reddish-violet (1.2) to colorless (3.2) |
| Major Application | Image producing materials, recording materials, resist composition, copier materials, inks, cleaners, cosmetics, dental adhesives |
| InChI | InChI=1S/C24H26O6/c1-26-16-10-12-19(22(14-16)29-4)24(25,18-8-6-7-9-21(18)28-3)20-13-11-17(27-2)15-23(20)30-5/h6-15,25H,1-5H3 |
| InChIKey | GEPSNGQKRLULHW-UHFFFAOYSA-N |
| SMILES | C(O)(C1C=CC=CC=1OC)(C1=CC=C(OC)C=C1OC)C1=CC=C(OC)C=C1OC |
Safety Information
PENTAMETHOXY RED Usage And Synthesis
| Uses | Pentamethoxy red is a kind of biochemical reagent. |
| References | [1] Bergmeyer, et al. "Biochemical reagents." Methods of Enzymatic Analysis. Academic Press, 1965. 967-1037. |
PENTAMETHOXY RED Preparation Products And Raw materials
