Introduction：Basic information about Permanent Violet RL CAS 6358-30-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Permanent Violet RL Basic information
| Product Name: | Permanent Violet RL |
| Synonyms: | Paintco violet 23-B;Paintco violet 23-R;Plasco violet 23-B;Plasco violet 23-R;Pigment Permanent Violet HB-197;6555 Bluish Permanent Violet RL;5,15-Diethyl-8,18-dichloro-5,15-dihydrodiindolo[3,2-b:3',2'-m]triphenodioxazine;Pigment Violet 23 |
| CAS: | 6358-30-1 |
| MF: | C35H23Cl2N3O2 |
| MW: | 588.48202 |
| EINECS: | 228-767-9 |
| Product Categories: | Organics |
| Mol File: | 6358-30-1.mol |
|
Permanent Violet RL Chemical Properties
| Melting point | 385°C (dec.) |
| density | 1.53 |
| storage temp. | Sealed in dry,Room Temperature |
| form | Solid |
| color | Dark Purple to Very Dark Purple |
| Cosmetics Ingredients Functions | COLORANT
HAIR DYEING |
| InChIKey | PRXZQJMIUPUILW-UHFFFAOYSA-N |
| SMILES | CCC1C2C=CC=CC=2C2C=C3C(=CC1=2)OC1=C(C2C(=C(Cl)C1=N3)OC1C=C3C(=CC=1N=2)C1C=CC=CC=1N3CC)Cl |
| LogP | 12.796 (est) |
| CAS DataBase Reference | 6358-30-1(CAS DataBase Reference) |
| EPA Substance Registry System | C.I. Pigment Violet 23 (6358-30-1) |
Safety Information
Permanent Violet RL Usage And Synthesis
| Chemical Properties | Carbazole Violet (Pigment Violet 23)is a bluish violet pigment that is uncommonly strong, resistant to solvents, and shows fair weatherfastness. |
| Uses | Carbazole Violet is used primarily as a shading pigment with copper phthalocyanines and for toning whites in a variety of systems. |
| Preparation | Pigment Violet 23 is formed by condensation of chloranil with 3-amino-N-ethylcarbazole. |
| Properties and Applications | | TEST ITEMS | SPECIFICATION | | APPEARANCE | VIOLET POWDER | | SHADE | BLUISH | | HEAT RESISTANCE | 300 °C min | | LIGHT FASTNESS | 7-8 | | ACID RESISTANCE | 5 | | ALKALI RESISTANCE | 5 | | FASTNESS TO BLEEDING | 5 | | OIL ABSORPTION | 40-45% | | SPECIFIC SURFACE | 28 m 2 /g | | DENSITY | 1.60 g/cm 3 | | RESIDUE ON 80 MESH | 5.0% max | | WATER SOLUBLE | 1.0% max | | VOLATITE 105 °C | 1.0% max | | TINTING STRENGTH | 100-105 % | |
Permanent Violet RL Preparation Products And Raw materials
| Raw materials | Hydrochloric acid-->Nitric acid-->Calcium chloride-->Bromoethane-->Sodium acetate trihydrate-->1,2-Dichlorobenzene-->Benzenesulfonyl chloride-->Carbazole-->3-Amino-9-ethylcarbazole-->Chloranil-->Benzyltrimethylammonium chloride |
