p-Naphtholbenzein CAS 145-50-6
Introduction：Basic information about p-Naphtholbenzein CAS 145-50-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
p-Naphtholbenzein Basic information
| Product Name: | p-Naphtholbenzein |
| Synonyms: | α-Naphtholbenzein,4,4′-(α-Hydroxybenzylidene)di-1-naphthol, p-naphtholbenzein;alpha-Naphtholbenzein, pure, 90% 10GR;alpha-Naphtholbenzein, pure, 90% 25GR;1-NAPHTHOLBENZEIN INDICATOR 5 G;α- naphthol quinone phenylMethane;MAG BIND EQUIPURE GDNA (1X96);1-Naphtholbenzein indicator Reag. Ph Eur;1(4H)-Naphthalenone, 4-(4-hydroxy-1-naphthalenyl)phenylmethylene- |
| CAS: | 145-50-6 |
| MF: | C27H18O2 |
| MW: | 374.43 |
| EINECS: | 205-656-3 |
| Product Categories: | Benzein;Analytical Chemistry;Indicator (pH);pH Indicators |
| Mol File: | 145-50-6.mol |
p-Naphtholbenzein Chemical Properties
| Melting point | 230-235 °C(lit.) |
| Boiling point | 463.44°C (rough estimate) |
| bulk density | 120-300kg/m3 |
| density | 1.0946 (rough estimate) |
| vapor density | 12.9 (vs air) |
| refractive index | 1.4875 (estimate) |
| storage temp. | Store at +5°C to +30°C. |
| solubility | Solubility Insoluble in water; soluble in ethanol, methanol |
| pka | 8.95(at 25℃) |
| form | Liquid |
| color | Pale Red-Brown |
| Odor | Odorless |
| PH | 0.0, green 0.8, yellow 10.0, blue-green 8.2, yellow |
| PH Range | Green (0.0) to yellow (0.8);Yellow (8.2) to green-blue (11.0) |
| Water Solubility | insoluble |
| ε(extinction coefficient) | ≥50000 at 207-213nm in methanol at 0.01g/L |
| λmax | 210nm |
| BRN | 3471575 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | 1S/C27H18O2/c28-25-16-14-23(19-10-4-6-12-21(19)25)27(18-8-2-1-3-9-18)24-15-17-26(29)22-13-7-5-11-20(22)24/h1-17,28H/b27-24- |
| InChIKey | VDDWRTZCUJCDJM-SOYKGTTHSA-N |
| SMILES | Oc1ccc(\C(c2ccccc2)=C3\C=CC(=O)c4ccccc34)c5ccccc15 |
| CAS DataBase Reference | 145-50-6(CAS DataBase Reference) |
| EPA Substance Registry System | 1(4H)-Naphthalenone, 4-[(4-hydroxy-1-naphthalenyl)phenylmethylene]- (145-50-6) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 29145000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 4 |
| Chemical Properties | deep red to rust-coloured crystals |
| Uses | alpha-Naphtholbenzein is a pH indicator (pH 0.0-0.8/ pH 8.2-10.0). Dyes and metabolites. |
p-Naphtholbenzein Preparation Products And Raw materials
