Introduction：Basic information about Ponesterone A CAS 13408-56-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Ponesterone A Basic information
| Product Name: | Ponesterone A |
| Synonyms: | 2β,3β,14α,20r,22r-pentahydroxy-5β-cholest-7-en-6-one;PONASTERONE A;2B,3B,14A,20R,22R-PENTAHYDROXY-5B-CHOLEST-7-EN-6-ONE;2BETA, 3BETA, 14ALPHA, 20R,22R-PENTAHYDROXY-5BETA-CHOLEST-7-EN-6-ONE;25-DEOXY-20-HYDROXYECDYSONE;25-DEOXYECDYSTERONE;Ponasterone A, >=98%;25-Deoxy-20-hydroxyecdysone, 25-Deoxyecdysterone, 2β,3β,14α,20R,22R-Pentahydroxy-5β-cholest-7-en-6-one |
| CAS: | 13408-56-5 |
| MF: | C27H44O6 |
| MW: | 464.63 |
| EINECS: | |
| Product Categories: | Steroids |
| Mol File: | 13408-56-5.mol |
|
Ponesterone A Chemical Properties
| Melting point | 259-260° (dec) |
| alpha | D15 +90° (methanol) |
| Boiling point | 640.5±55.0 °C(Predicted) |
| density | 1.22±0.1 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | Methanol (Slightly, Sonicated), Pyridine (Slightly) |
| pka | 14.13±0.70(Predicted) |
| form | White to off-white powder. |
| color | White to Off-White |
| biological source | synthetic (organic) |
| InChIKey | PJYYBCXMCWDUAZ-JJJZTNILSA-N |
| SMILES | C12=CC([C@]3([H])C[C@@H](O)[C@@H](O)C[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@H](CC[C@@]21O)[C@](O)(C)[C@H](O)CCC(C)C)=O |&1:3,6,8,11,13,17,19,22,24,27,r| |
| CAS DataBase Reference | 13408-56-5(CAS DataBase Reference) |
Safety Information
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
Ponesterone A Usage And Synthesis
| Description | Ponesterone A, a steroidal compound, falls under the category of ecdysone and can be found in various sources throughout nature. It was first isolated from insect plants by Nakanishi and Horm in 1966. Compared to β-ecdysone, Ponesterone proves to be 3-100 times more potent in specific neurosensory systems. |
| Uses | Ponasterone A has been used to induce the expression of human huntingtin (HTT). |
| Definition | ChEBI: Ponasterone A is a 2beta-hydroxy steroid, a 3beta-hydroxy steroid, a 14alpha-hydroxy steroid, a 20-hydroxy steroid, a 22-hydroxy steroid, a 6-oxo steroid and a phytoecdysteroid. |
| Biochem/physiol Actions | Ponasterone A is an analogue of ecdysone. It induced death of non-adapted insects may be related to PoA regulating different set of genes when compared to 20E. |
| storage | +4°C |
Ponesterone A Preparation Products And Raw materials
