Introduction:Basic information about Procysteine CAS 19771-63-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Procysteine Basic information
| Product Name: | Procysteine |
| Synonyms: | (4R)-2-Oxothiazolidine-4-carboxylic acid;(4R)-2-Oxothiazolidine-4α-carboxylic acid;L-2-Thiazolidinone-4-carboxylic Acid,L-2-Oxothiazolidine-4-carboxylic Acid;(4R)-2-ketothiazolidine-4-carboxylic acid;L-Thiazolidin-2-one-4-carboxylic acid, OTC, Procysteine, OTZ;Oxothiazolidine carboxylate;4-Thiazolidinecarboxylicacid, 2-oxo-, (4R)-;L-2-Thiazolidinone-4-carboxylic Acid |
| CAS: | 19771-63-2 |
| MF: | C4H5NO3S |
| MW: | 147.15 |
| EINECS: | 200-154-8 |
| Product Categories: | CARBOXYLICACID;whitening and anti-aging material and other functions in cosmetics |
| Mol File: | 19771-63-2.mol |
|
Procysteine Chemical Properties
| Melting point | 174 °C (dec.)(lit.) |
| alpha | -60 º (c=1 in H2O) |
| density | 1.582±0.06 g/cm3(Predicted) |
| refractive index | -64 ° (C=1, H2O) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| pka | pKa (22°): 3.32 |
| form | Powder |
| color | White to Off-white |
| Water Solubility | Soluble in water |
| Merck | 13,7019 |
| BRN | 4179169 |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | InChI=1S/C4H5NO3S/c6-3(7)2-1-9-4(8)5-2/h2H,1H2,(H,5,8)(H,6,7)/t2-/m0/s1 |
| InChIKey | BMLMGCPTLHPWPY-REOHCLBHSA-N |
| SMILES | S1C[C@@H](C(O)=O)NC1=O |
| CAS DataBase Reference | 19771-63-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | XJ5426650 |
| HS Code | 2934.20.8000 |
| Storage Class | 11 - Combustible Solids |
Procysteine Usage And Synthesis
| Chemical Properties | White crystalline powder |
| Uses | (R)-(-)-2-Oxothiazolidine-4-carboxylic Acid or Procysteine is a precursor to glutathione (GSH) which is an important antioxidant in plants, animals and fungi. |
| Definition | ChEBI: (4R)-2-oxo-4-thiazolidinecarboxylic acid is an organonitrogen compound and an organooxygen compound. It is functionally related to an alpha-amino acid. |
| Biological Activity | 2-Oxothiazolidine-4-carboxylic acid augments glutathione and cysteine production. |
| in vivo | Oxothiazolidinecarboxylic acid treatment attenuates plantaris atrophy, restored glutathione levels, and increased catalase, Cu/Zn-SOD1, and Mn-SOD2 mRNA expression, but did not reduce other markers of oxidant stress or levels of these catabolic factors[1]. | Animal Model: | Male Sprague-Dawley rats (200-250 g, n= 6-7 rats/group)[1]. | | Dosage: | 0.35% (w/v). | | Administration: | Added to their diets at a concentration of 0.35% (w/v) for the final 12 wk. | | Result: | Increased fiber CSAs compared to the non-supplemented, alcohol-fed group. |
|
Procysteine Preparation Products And Raw materials