Introduction:Basic information about P-XYLENE-D10 CAS 41051-88-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
P-XYLENE-D10 Basic information
| Product Name: | P-XYLENE-D10 |
| Synonyms: | 1,4-Di(methyl-d3)benzene-d4;Benzene-1,2,4,5-d4-, 3,6-di(methyl-d3)-;1,4-Dimethylbenzene-d10;p-Xylene-d{10}, Isotopic;1,2,4,5-tetradeuterio-3,6-bis(trideuteriomethyl)benzene;Benzene-1,2,4,5-d4,3,6-di(methyl-d3)-;(2H10)-p-xylene;P-XYLENE-D10, 99 ATOM % D |
| CAS: | 41051-88-1 |
| MF: | C8D10 |
| MW: | 116.23 |
| EINECS: | 255-193-6 |
| Product Categories: | |
| Mol File: | 41051-88-1.mol |
|
P-XYLENE-D10 Chemical Properties
| Melting point | 13 °C |
| Boiling point | 135 °C(lit.) |
| density | 0.948 g/mL at 25 °C(lit.) |
| refractive index | n20/D 1.492(lit.) |
| Fp | 86 °F |
| storage temp. | Store below +30°C. |
| solubility | 0.2g/l |
| form | Liquid |
| explosive limit | 1.1-7%(V) |
| Water Solubility | Insoluble in water. |
| Sensitive | Moisture Sensitive |
| Merck | 14,10081 |
| InChI | InChI=1S/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3/i1D3,2D3,3D,4D,5D,6D |
| InChIKey | URLKBWYHVLBVBO-ZGYYUIRESA-N |
| SMILES | C([2H])([2H])([2H])C1C([2H])=C([2H])C(=C([2H])C=1[2H])C([2H])([2H])[2H] |
| CAS DataBase Reference | 41051-88-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 10-20/21-38 |
| Safety Statements | 23-36/37 |
| RIDADR | UN 1307 3/PG 3 |
| WGK Germany | 3 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 28459000 |
P-XYLENE-D10 Usage And Synthesis
| Chemical Properties | clear colorless liquid |
| Uses | p-Xylene-d10 may be used as an internal standard (IS) for GC/MS analysis of volatile organic compounds in the emissions from a landfill. |
| General Description | p-Xylene-d10 is a deuterated derivative of p-xylene. It has an isotopic purity of 98atom%D. A series of solutions of p-xylene dissolved in the first 12 members of the 4-n-alkyloxy-4′-cyanobiphenyls (NOCB) were prepared. Principal components Szz and Sxx - Syy of the second rank orientational ordering matrix of these solutions were determined by deuterium NMR analysis. It is an anthropogenic volatile organic compounds (VOC), which is useful for the formation of secondary organic aerosol (SOA). |
P-XYLENE-D10 Preparation Products And Raw materials
| Raw materials | 2,6,9,10-Anthracenetetracarbonitrile-->P-XYLENE |
| Preparation Products | Pyrimidine-->TEREPHTHALIC-D4 ACID-->P-XYLENE-ALPHA,ALPHA,ALPHA,ALPHA',ALPHA',ALPHA'-D6-->Pyrazine-->Pyridazine |