Introduction：Basic information about CAS 58816-79-8|1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carbonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carbonyl chloride |
|---|
| CAS Number | 58816-79-8 | Molecular Weight | 344.51000 |
|---|
| Density | 1.77g/cm3 | Boiling Point | 95-96ºC |
|---|
| Molecular Formula | C7ClF11O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 37.9ºC |
|---|
Names
| Name | 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carbonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.77g/cm3 |
|---|
| Boiling Point | 95-96ºC |
|---|
| Molecular Formula | C7ClF11O |
|---|
| Molecular Weight | 344.51000 |
|---|
| Flash Point | 37.9ºC |
|---|
| Exact Mass | 343.94600 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 3.65020 |
|---|
| Index of Refraction | 1.322 |
|---|
| InChIKey | JBOWALSHDVHATH-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
|---|
Safety Information
| Risk Phrases | 34 |
|---|
| Safety Phrases | 26-28-36/37/39 |
|---|
| RIDADR | UN 3265 |
|---|
Synonyms
| 1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexanecarbonyl chloride |
| PC3715 |
| undecafluorocyclohexanecarbonyl chloride |
| Perfluorocyclohexanecarbonyl chloride |
