Introduction：Basic information about CAS 588696-85-9|7-Chloro-8-methyl-2-pyridin-4-ylquinoline-4-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-Chloro-8-methyl-2-pyridin-4-ylquinoline-4-carboxylic acid |
|---|
| CAS Number | 588696-85-9 | Molecular Weight | 298.72400 |
|---|
| Density | 1.382g/cm3 | Boiling Point | 506ºC at 760 mmHg |
|---|
| Molecular Formula | C16H11ClN2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 259.8ºC |
|---|
Names
| Name | 7-Chloro-8-methyl-2-pyridin-4-ylquinoline-4-carboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.382g/cm3 |
|---|
| Boiling Point | 506ºC at 760 mmHg |
|---|
| Molecular Formula | C16H11ClN2O2 |
|---|
| Molecular Weight | 298.72400 |
|---|
| Flash Point | 259.8ºC |
|---|
| Exact Mass | 298.05100 |
|---|
| PSA | 63.08000 |
|---|
| LogP | 3.95680 |
|---|
| Index of Refraction | 1.678 |
|---|
| InChIKey | CFKNJONHEVWXHA-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c(Cl)ccc2c(C(=O)O)cc(-c3ccncc3)nc12 |
|---|
