Introduction:Basic information about CAS 78105-37-0|2-Chloro-3-nitroquinoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro-3-nitroquinoline |
|---|
| CAS Number | 78105-37-0 | Molecular Weight | 208.601 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 345.4±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H5ClN2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 162.7±22.3 °C |
|---|
Names
| Name | 2-Chloro-3-nitroquinoline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 345.4±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H5ClN2O2 |
|---|
| Molecular Weight | 208.601 |
|---|
| Flash Point | 162.7±22.3 °C |
|---|
| Exact Mass | 208.003952 |
|---|
| PSA | 58.71000 |
|---|
| LogP | 2.39 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.688 |
|---|
| InChIKey | PQZXGIIGQHCVAU-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cc2ccccc2nc1Cl |
|---|
Synonyms
| Quinoline, 2-chloro-3-nitro- |
| 2-chloro-3-nitro-quinoline |
| 2-Chlor-3-nitro-chinolin |
| 2-Chloro-3-nitroquinoline |
| Quinoline,2-chloro-3-nitro |