Introduction:Basic information about CAS 187949-02-6|Albaconazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Albaconazole |
|---|
| CAS Number | 187949-02-6 | Molecular Weight | 431.823 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 658.9±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C20H16ClF2N5O2 | Melting Point | 124-126°C |
|---|
| MSDS | / | Flash Point | 352.3±34.3 °C |
|---|
Names
| Name | 7-chloro-3-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1,2,4-triazol-1-yl)butan-2-yl]quinazolin-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 658.9±65.0 °C at 760 mmHg |
|---|
| Melting Point | 124-126°C |
|---|
| Molecular Formula | C20H16ClF2N5O2 |
|---|
| Molecular Weight | 431.823 |
|---|
| Flash Point | 352.3±34.3 °C |
|---|
| Exact Mass | 431.096069 |
|---|
| PSA | 85.83000 |
|---|
| LogP | 3.00 |
|---|
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.667 |
|---|
| InChIKey | UHIXWHUVLCAJQL-MPBGBICISA-N |
|---|
| SMILES | CC(n1cnc2cc(Cl)ccc2c1=O)C(O)(Cn1cncn1)c1ccc(F)cc1F |
|---|
| Storage condition | -20°C Freezer |
|---|
Synonyms
| albacolazole |
| 7-Chloro-3-[(2R,3R)-3-(2,4-difluorophenyl)-3-hydroxy-4-(1H-1,2,4-triazol-1-yl)-2-butanyl]-4(3H)-quinazolinone |
| (1R,2R)-7-chloro-3-[2-(2,4-difluorophenyl)-2-hydroxy-1-methyl-3-(1H-1,2,4-triazol-1-yl)propyl]quinazolin-4(3H)-one |
| UNII-YDW24Y8IAB |
| Albaconazole |
| UR 9825 |
| Albaconazole [INN] |
| (1R,2R)-7-chloro-3-[2-(2,4-difluorophenyl)-2-hydroxy-1-methyl-3-(1H-1,2,4-triazol-1-yl)propyl]quinazilin-4(3H)-one |
| Albaconazol |
| 4(3H)-Quinazolinone, 7-chloro-3-[(1R,2R)-2-(2,4-difluorophenyl)-2-hydroxy-1-methyl-3-(1H-1,2,4-triazol-1-yl)propyl]- |
| 7-chloro-3-((1r,2r)-2-(2,4-difluorophenyl)-2-hydroxy-1-methyl-3-(1h-1,2,4-triazol-1-yl)propyl)quinazolin-4(3h)-one |