Introduction:Basic information about CAS 34571-16-9|Dechlorane 604 Component A, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dechlorane 604 Component A |
|---|
| CAS Number | 34571-16-9 | Molecular Weight | 692.505 |
|---|
| Density | 2.5±0.1 g/cm3 | Boiling Point | 526.4±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H4Br4Cl6 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 309.2±20.2 °C |
|---|
| Symbol | GHS05 | Signal Word | Danger |
|---|
Names
| Name | Dechlorane 604 Component A |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.5±0.1 g/cm3 |
|---|
| Boiling Point | 526.4±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H4Br4Cl6 |
|---|
| Molecular Weight | 692.505 |
|---|
| Flash Point | 309.2±20.2 °C |
|---|
| Exact Mass | 685.517761 |
|---|
| LogP | 8.84 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.744 |
|---|
| InChIKey | PHYHWKJTYWPNCS-UHFFFAOYSA-N |
|---|
| SMILES | C1C(C2(C(=C(C1(C2(Cl)Cl)Cl)Cl)Cl)Cl)C3=CC(=C(C(=C3Br)Br)Br)Br |
|---|
Safety Information
| Symbol | GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314 |
|---|
| Precautionary Statements | P260-P280-P303 + P361 + P353-P304 + P340 + P310-P305 + P351 + P338 |
|---|
| RIDADR | UN 3261 8 / PGII |
|---|
Synonyms
| Bicyclo(2.2.1)hept-2-ene, 1,2,3,4,7,7-hexachloro-5-(tetrabromophenyl)- |
| 5-(TetrabroMophenyl)-1,2,3,4,7,7-hexachloro-2-norbornene |
| 1,2,3,4,7,7-hexachloro-5-(tetrabromophenyl)bicyclo[2.2.1]hept-2-ene |
| 1,2,3,4,7,7-Hexachloro-5-(2,3,4,5-tetrabromophenyl)bicyclo[2.2.1]hept-2-ene |
| (Tetrabromophenyl) hexachloronorbornene |
| Bicyclo[2.2.1]hept-2-ene, 1,2,3,4,7,7-hexachloro-5-(2,3,4,5-tetrabromophenyl)- |
| 1,2,3,4,7,7-hexachloro-5-(tetrabromophenyl)bicyclo(2.2.1)hept-2-ene |
| Hexachlorocyclopentadiene-tetrabroMostyrene Adduct |
| 1,2,3,4,7,7-hexachloro-5-(tetrabromophenyl)-bicyclo[2.2.1]hept-2-en |