Introduction：Basic information about CAS 77-11-2|4-[bis(isopropyl)amino]-2,2-diphenylbutyronitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[bis(isopropyl)amino]-2,2-diphenylbutyronitrile |
|---|
| CAS Number | 77-11-2 | Molecular Weight | 320.47100 |
|---|
| Density | 1.002g/cm3 | Boiling Point | 438.6ºC at 760 mmHg |
|---|
| Molecular Formula | C22H28N2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 177.5ºC |
|---|
Names
| Name | 4-[di(propan-2-yl)amino]-2,2-diphenylbutanenitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.002g/cm3 |
|---|
| Boiling Point | 438.6ºC at 760 mmHg |
|---|
| Molecular Formula | C22H28N2 |
|---|
| Molecular Weight | 320.47100 |
|---|
| Flash Point | 177.5ºC |
|---|
| Exact Mass | 320.22500 |
|---|
| PSA | 27.03000 |
|---|
| LogP | 5.00518 |
|---|
| Index of Refraction | 1.54 |
|---|
| InChIKey | VNZNXSQQHNCELU-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)N(CCC(C#N)(c1ccccc1)c1ccccc1)C(C)C |
|---|
Synonyms
| 4-(dipropan-2-ylamino)-2,2-diphenylbutanenitrile |
| 4-diisopropylamino-2,2-diphenyl-butyronitrile |
| 2,2-Diphenyl-4-diisopropylamino-butyronitril |
| 4-(bis(isopropyl)amino)-2,2-diphenylbutyronitrile |
| EINECS 201-005-2 |
