Introduction:Basic information about CAS 79922-55-7|2,2-Bis[4-(4-maleimidophenoxy)phenyl]propane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2-Bis[4-(4-maleimidophenoxy)phenyl]propane |
|---|
| CAS Number | 79922-55-7 | Molecular Weight | 570.59100 |
|---|
| Density | 1.34g/cm3 | Boiling Point | 729.2ºC at 760 mmHg |
|---|
| Molecular Formula | C35H26N2O6 | Melting Point | 165° C |
|---|
| MSDS | / | Flash Point | 394.8ºC |
|---|
Names
| Name | 1-[4-[4-[2-[4-[4-(2,5-dioxopyrrol-1-yl)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]pyrrole-2,5-dione |
|---|
Chemical & Physical Properties
| Density | 1.34g/cm3 |
|---|
| Boiling Point | 729.2ºC at 760 mmHg |
|---|
| Melting Point | 165° C |
|---|
| Molecular Formula | C35H26N2O6 |
|---|
| Molecular Weight | 570.59100 |
|---|
| Flash Point | 394.8ºC |
|---|
| Exact Mass | 570.17900 |
|---|
| PSA | 93.22000 |
|---|
| LogP | 6.58590 |
|---|
| Index of Refraction | 1.661 |
|---|
| InChIKey | XAZPKEBWNIUCKF-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(c1ccc(Oc2ccc(N3C(=O)C=CC3=O)cc2)cc1)c1ccc(Oc2ccc(N3C(=O)C=CC3=O)cc2)cc1 |
|---|