Introduction：Basic information about CAS 79957-95-2|Chloro(dimethyl)(2,4,4-trimethylpentyl)silane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Chloro(dimethyl)(2,4,4-trimethylpentyl)silane |
|---|
| CAS Number | 79957-95-2 | Molecular Weight | 206.828 |
|---|
| Density | 0.9±0.1 g/cm3 | Boiling Point | 213.9±9.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H23ClSi | Melting Point | / |
|---|
| MSDS | / | Flash Point | 73.4±8.3 °C |
|---|
Names
| Name | chloro-dimethyl-(2,4,4-trimethylpentyl)silane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.9±0.1 g/cm3 |
|---|
| Boiling Point | 213.9±9.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H23ClSi |
|---|
| Molecular Weight | 206.828 |
|---|
| Flash Point | 73.4±8.3 °C |
|---|
| Exact Mass | 206.125748 |
|---|
| LogP | 5.34 |
|---|
| Vapour Pressure | 0.2±0.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.427 |
|---|
| InChIKey | XYMJSYGBKPQLCS-UHFFFAOYSA-N |
|---|
| SMILES | CC(CC(C)(C)C)C[Si](C)(C)Cl |
|---|
Synonyms
| DIISOOCTYLDIMETHYLCHLOROSILANE |
| Silane,chlorodimethyl(2,4,4-trimethylpentyl) |
| Silane, chlorodimethyl(2,4,4-trimethylpentyl)- |
| EINECS 279-358-7 |
| Chloro(dimethyl)(2,4,4-trimethylpentyl)silane |
| Chlorodimethyl(2,4,4-trimethylpentyl)silane |
