Introduction:Basic information about CAS 64379-91-5|3-Trifluoromethyl-cinnamoyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Trifluoromethyl-cinnamoyl chloride |
|---|
| CAS Number | 64379-91-5 | Molecular Weight | 234.602 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 232.9±0.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H6ClF3O | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 93.9±0.0 °C |
|---|
| Symbol | GHS05 | Signal Word | Danger |
|---|
Names
| Name | trans-3-(Trifluoromethyl)cinnamoyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 232.9±0.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H6ClF3O |
|---|
| Molecular Weight | 234.602 |
|---|
| Flash Point | 93.9±0.0 °C |
|---|
| Exact Mass | 234.005920 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 4.05 |
|---|
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.515 |
|---|
| InChIKey | HGQSKTQYEWJJRZ-SNAWJCMRSA-N |
|---|
| SMILES | O=C(Cl)C=Cc1cccc(C(F)(F)F)c1 |
|---|
Safety Information
| Symbol | GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
|---|
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | C,Xn |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | 26-36/37/39-45 |
|---|
| RIDADR | UN 3265 8/PG 2 |
|---|
| WGK Germany | 3.0 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 8.0 |
|---|
Synonyms
| (2E)-3-[3-(Trifluoromethyl)phenyl]-2-propenoyl chloride |
| 2-Propenoyl chloride, 3-[3-(trifluoromethyl)phenyl]-, (2E)- |
| 3-[3-(trifluoromethyl)phenyl]prop-2-enoyl chloride |
| MFCD00075514 |
| 3-Trifluoromethyl-cinnamoyl chloride |
| (2E)-3-[3-(Trifluoromethyl)phenyl]acryloyl chloride |