Introduction：Basic information about CAS 64051-39-4|(2,3-dipentylphenyl) dihydrogen phosphate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2,3-dipentylphenyl) dihydrogen phosphate |
|---|
| CAS Number | 64051-39-4 | Molecular Weight | 314.35700 |
|---|
| Density | 1.119g/cm3 | Boiling Point | 456.8ºC at 760 mmHg |
|---|
| Molecular Formula | C16H27O4P | Melting Point | / |
|---|
| MSDS | / | Flash Point | 230ºC |
|---|
Names
| Name | (2,3-dipentylphenyl) dihydrogen phosphate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.119g/cm3 |
|---|
| Boiling Point | 456.8ºC at 760 mmHg |
|---|
| Molecular Formula | C16H27O4P |
|---|
| Molecular Weight | 314.35700 |
|---|
| Flash Point | 230ºC |
|---|
| Exact Mass | 314.16500 |
|---|
| PSA | 76.57000 |
|---|
| LogP | 4.62350 |
|---|
| Index of Refraction | 1.518 |
|---|
| InChIKey | RVQOXEIOIUDSFU-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCc1cccc(OP(=O)(O)O)c1CCCCC |
|---|
Synonyms
| 2,3-dipentylphenyl dihydrogenphosphate |
| Phenol,dipentyl-,dihydrogen phosphate |
| Dipentylphenyl dihydrogen phosphate |
| Dipentylphenol dihydrogen phosphate |
| EINECS 264-631-5 |
