Introduction：Basic information about CAS 63302-98-7|tris[(1-methyl-1-phenylethyl)phenyl] phosphate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tris[(1-methyl-1-phenylethyl)phenyl] phosphate |
|---|
| CAS Number | 63302-98-7 | Molecular Weight | 292.26700 |
|---|
| Density | 1.274g/cm3 | Boiling Point | 460.6ºC at 760 mmHg |
|---|
| Molecular Formula | C15H17O4P | Melting Point | / |
|---|
| MSDS | / | Flash Point | 232.4ºC |
|---|
Names
| Name | [2-(2-phenylpropan-2-yl)phenyl] dihydrogen phosphate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.274g/cm3 |
|---|
| Boiling Point | 460.6ºC at 760 mmHg |
|---|
| Molecular Formula | C15H17O4P |
|---|
| Molecular Weight | 292.26700 |
|---|
| Flash Point | 232.4ºC |
|---|
| Exact Mass | 292.08600 |
|---|
| PSA | 76.57000 |
|---|
| LogP | 3.48400 |
|---|
| Index of Refraction | 1.58 |
|---|
| InChIKey | IPMOLHAIDJEBQN-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C1=CC=CC=C1)C2=CC=CC=C2OP(=O)(O)O |
|---|
Synonyms
| EINECS 264-088-4 |
| Phenol,(1-methyl-1-phenylethyl)-,1,1',1''-phosphate |
| Tris((1-methyl-1-phenylethyl)phenyl) phosphate |
| Phenol,(1-methyl-1-phenylethyl)-,phosphate |
