Introduction:Basic information about CAS 71002-18-1|2-[[4-[bis[2-(acetyloxy)ethyl]amino]-2-methylphenyl]azo]benzothiazol-6-yl thio, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[[4-[bis[2-(acetyloxy)ethyl]amino]-2-methylphenyl]azo]benzothiazol-6-yl thiocyanate |
|---|
| CAS Number | 71002-18-1 | Molecular Weight | 497.59000 |
|---|
| Density | 1.33g/cm3 | Boiling Point | 661.8ºC at 760 mmHg |
|---|
| Molecular Formula | C23H23N5O4S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 354.1ºC |
|---|
Names
| Name | 2-[N-(2-acetyloxyethyl)-3-methyl-4-[(6-thiocyanato-1,3-benzothiazol-2-yl)diazenyl]anilino]ethyl acetate |
|---|
Chemical & Physical Properties
| Density | 1.33g/cm3 |
|---|
| Boiling Point | 661.8ºC at 760 mmHg |
|---|
| Molecular Formula | C23H23N5O4S2 |
|---|
| Molecular Weight | 497.59000 |
|---|
| Flash Point | 354.1ºC |
|---|
| Exact Mass | 497.11900 |
|---|
| PSA | 170.78000 |
|---|
| LogP | 5.52588 |
|---|
| Index of Refraction | 1.647 |
|---|
| InChIKey | PUGQCSKAHXIMHN-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)OCCN(CCOC(C)=O)c1ccc(N=Nc2nc3ccc(SC#N)cc3s2)c(C)c1 |
|---|