Introduction：Basic information about CAS 82-75-7|1-naphthylamine-8-sulfonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-naphthylamine-8-sulfonic acid |
|---|
| CAS Number | 82-75-7 | Molecular Weight | 223.248 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C10H9NO3S | Melting Point | >350°C |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 8-Amino-1-Naphthalenesulfonic Acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Melting Point | >350°C |
|---|
| Molecular Formula | C10H9NO3S |
|---|
| Molecular Weight | 223.248 |
|---|
| Exact Mass | 223.030319 |
|---|
| PSA | 88.77000 |
|---|
| LogP | 0.42 |
|---|
| Index of Refraction | 1.713 |
|---|
| InChIKey | CYJJLCDCWVZEDZ-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cccc2cccc(S(=O)(=O)O)c12 |
|---|
Safety Information
| Hazard Codes | C:Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S27-S36-S45 |
|---|
| RIDADR | UN 3261 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2921450090 |
|---|
Customs
| HS Code | 2921450090 |
|---|
| Summary | 2921450090 1-naphthylamine (α-naphthylamine), 2-naphthylamine (β-naphthylamine) and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 1-naphthylamine-8-sulfonic acid |
| EINECS 201-437-1 |
| 8-Amino-1-naphthalenesulfonic acid |
| 1-Naphthalenesulfonic acid, 8-amino- |
| 8-Aminonaphthalene-1-sulfonic acid |
| Peri acid |
| MFCD00035730 |
