Introduction:Basic information about CAS 98919-15-4|1,2-dichloro-4-(2,2-diethoxyethoxy)benzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,2-dichloro-4-(2,2-diethoxyethoxy)benzene |
|---|
| CAS Number | 98919-15-4 | Molecular Weight | 279.16000 |
|---|
| Density | 1.198g/cm3 | Boiling Point | 352.1ºC at 760mmHg |
|---|
| Molecular Formula | C12H16Cl2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 123.6ºC |
|---|
Names
| Name | 1,2-dichloro-4-(2,2-diethoxyethoxy)benzene |
|---|
Chemical & Physical Properties
| Density | 1.198g/cm3 |
|---|
| Boiling Point | 352.1ºC at 760mmHg |
|---|
| Molecular Formula | C12H16Cl2O3 |
|---|
| Molecular Weight | 279.16000 |
|---|
| Flash Point | 123.6ºC |
|---|
| Exact Mass | 278.04800 |
|---|
| PSA | 27.69000 |
|---|
| LogP | 3.77130 |
|---|
| Index of Refraction | 1.507 |
|---|
| InChIKey | LVANXKPFPPBKDQ-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(COc1ccc(Cl)c(Cl)c1)OCC |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|