Introduction：Basic information about CAS 7724-15-4|2,6-tns, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,6-tns |
|---|
| CAS Number | 7724-15-4 | Molecular Weight | 313.37100 |
|---|
| Density | 1.37 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C17H15NO3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 6-(4-methylanilino)naphthalene-2-sulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.37 g/cm3 |
|---|
| Molecular Formula | C17H15NO3S |
|---|
| Molecular Weight | 313.37100 |
|---|
| Exact Mass | 313.07700 |
|---|
| PSA | 74.78000 |
|---|
| LogP | 5.29230 |
|---|
| Index of Refraction | 1.692 |
|---|
| InChIKey | VTRBOZNMGVDGHY-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(Nc2ccc3cc(S(=O)(=O)O)ccc3c2)cc1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R38 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2921499090 |
|---|
Customs
| HS Code | 2921499090 |
|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 6-p-toluidinonaphthalene-2-sulfonic acid |
| 6-p-Toluidinonaphthalene-2-sulphonic acid |
| EINECS 231-769-2 |
| 2-Naphthalenesulfonic acid,6-[(4-methylphenyl)amino] |
| 2-(p-Toluidinyl)naphthalene-6-sulfonic acid |
| 2-(p-toluidinyl)naphthalene-6-sulfonate |
| MFCD00171528 |
| 6-[(4-methylphenyl)amino]naphthalene-2-sulfonic acid |
| 6-(p-Toluidino)-2-naphthalene sulfonic acid |
| 2-(4-Toluidino)-6-naphthalenesulfonic acid |
| 2-(p-toluidinyl)naphtalene-6-sulfonic acid |
