Introduction：Basic information about CAS 4507-84-0|3-Nitro-1-naphthoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Nitro-1-naphthoic acid |
|---|
| CAS Number | 4507-84-0 | Molecular Weight | 217.178 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 445.2±28.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H7NO4 | Melting Point | 270.5-271.5 °C |
|---|
| MSDS | / | Flash Point | 197.4±12.5 °C |
|---|
Names
| Name | 3-nitronaphthalene-1-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 445.2±28.0 °C at 760 mmHg |
|---|
| Melting Point | 270.5-271.5 °C |
|---|
| Molecular Formula | C11H7NO4 |
|---|
| Molecular Weight | 217.178 |
|---|
| Flash Point | 197.4±12.5 °C |
|---|
| Exact Mass | 217.037506 |
|---|
| PSA | 83.12000 |
|---|
| LogP | 3.05 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.706 |
|---|
| InChIKey | JTNZIGOFCKHWDV-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc([N+](=O)[O-])cc2ccccc12 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 3-nitro-5,6,7,8-tetrahydro-1-naphthoic acid |
| 3-nitro-naphthalene-1-carboxylic acid |
| 3-Nitro-1-napthoic acid |
| 3-Nitro-1-naphthoic acid |
| 3-nitro-1-napthalenecarboxylic acid |
| 1-Naphthalenecarboxylic acid,3-nitro |
| 1-Naphthalenecarboxylic acid, 3-nitro- |
