Introduction：Basic information about CAS 6526-72-3|2-Nitrocumene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Nitrocumene |
|---|
| CAS Number | 6526-72-3 | Molecular Weight | 165.189 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 256.4±9.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H11NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 108.5±11.5 °C |
|---|
Names
| Name | 1-nitro-2-propan-2-ylbenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 256.4±9.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H11NO2 |
|---|
| Molecular Weight | 165.189 |
|---|
| Flash Point | 108.5±11.5 °C |
|---|
| Exact Mass | 165.078979 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 3.29 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.533 |
|---|
| InChIKey | BSMKYQUHXQAVKG-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)c1ccccc1[N+](=O)[O-] |
|---|
Safety Information
| Risk Phrases | 20/21/22 |
|---|
| Safety Phrases | 23-36/37/39 |
|---|
| HS Code | 2904209090 |
|---|
Customs
| HS Code | 2904209090 |
|---|
| Summary | 2904209090 derivatives containing only nitro or only nitroso groups。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 1-isopropyl-2-nitro-benzene |
| 2-Nitrocumene |
| 1-Isopropyl-2-nitrobenzene |
| o-isopropylnitrobenzene |
| 1-Isopropyl-2-nitro-benzol |
| 2-Isopropylnitrobenzene |
| EINECS 229-415-7 |
| Benzene, 1-(1-methylethyl)-2-nitro- |
| 2-i-propyl-nitrobenzene |
| o-Nitrocumene |
| 2-Nitroisopropylbenzene |
