Introduction：Basic information about CAS 89466-05-7|(3-amino-5-nitrophenyl)boronic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (3-amino-5-nitrophenyl)boronic acid |
|---|
| CAS Number | 89466-05-7 | Molecular Weight | 181.94200 |
|---|
| Density | 1.48g/cm3 | Boiling Point | 484.1ºC at 760 mmHg |
|---|
| Molecular Formula | C6H7BN2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 246.6ºC |
|---|
Names
| Name | (3-amino-5-nitrophenyl)boronic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.48g/cm3 |
|---|
| Boiling Point | 484.1ºC at 760 mmHg |
|---|
| Molecular Formula | C6H7BN2O4 |
|---|
| Molecular Weight | 181.94200 |
|---|
| Flash Point | 246.6ºC |
|---|
| Exact Mass | 182.05000 |
|---|
| PSA | 112.30000 |
|---|
| Index of Refraction | 1.617 |
|---|
| InChIKey | KLVJZQJSYAKUKK-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cc(B(O)O)cc([N+](=O)[O-])c1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
Synonyms
| 3-dihydroxyboranyl-5-nitro-aniline |
| 3-Amino-5-nitrophenyl boronic acid |
| 5-Nitro-3-amino-phenylboronsaeure |
| 3-Amino-5-nitrobenzeneboronic acid |
| 3-BORONO-5-NITROANILINE |
| 3-Dihydroxyboryl-5-nitro-anilin |
