Introduction：Basic information about CAS 49594-75-4|3-(4-ethylbenzoyl)propionic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(4-ethylbenzoyl)propionic acid |
|---|
| CAS Number | 49594-75-4 | Molecular Weight | 206.23800 |
|---|
| Density | 1.136g/cm3 | Boiling Point | 398.6ºC at 760mmHg |
|---|
| Molecular Formula | C12H14O3 | Melting Point | 92-94°C |
|---|
| MSDS | / | Flash Point | 209ºC |
|---|
Names
| Name | 4-(4-ethylphenyl)-4-oxobutanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.136g/cm3 |
|---|
| Boiling Point | 398.6ºC at 760mmHg |
|---|
| Melting Point | 92-94°C |
|---|
| Molecular Formula | C12H14O3 |
|---|
| Molecular Weight | 206.23800 |
|---|
| Flash Point | 209ºC |
|---|
| Exact Mass | 206.09400 |
|---|
| PSA | 54.37000 |
|---|
| LogP | 2.29650 |
|---|
| InChIKey | ZLHLIRYSBPOFQB-UHFFFAOYSA-N |
|---|
| SMILES | CCc1ccc(C(=O)CCC(=O)O)cc1 |
|---|
Safety Information
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
