Introduction：Basic information about CAS 77147-14-9|2,3,5,6-TETRAFLUOROTHIOPHENOL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,3,5,6-TETRAFLUOROTHIOPHENOL |
|---|
| CAS Number | 77147-14-9 | Molecular Weight | 252.26800 |
|---|
| Density | 1.377g/cm3 | Boiling Point | 462ºC at 760 mmHg |
|---|
| Molecular Formula | C15H12N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 233.2ºC |
|---|
Names
| Name | 2-[(3-aminophenyl)methyl]isoindole-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.377g/cm3 |
|---|
| Boiling Point | 462ºC at 760 mmHg |
|---|
| Molecular Formula | C15H12N2O2 |
|---|
| Molecular Weight | 252.26800 |
|---|
| Flash Point | 233.2ºC |
|---|
| Exact Mass | 252.09000 |
|---|
| PSA | 63.40000 |
|---|
| LogP | 2.58410 |
|---|
| Index of Refraction | 1.703 |
|---|
| InChIKey | FOBVDBSEYFIUCA-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cccc(CN2C(=O)c3ccccc3C2=O)c1 |
|---|
Safety Information
Customs
| HS Code | 2925190090 |
|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| N-(3-Amino-benzyl)-phthalimid |
| AC-6640 |
| 2-(3-Amino-benzyl)-isoindole-1,3-dione |
| 3-(1-phthalimidemethyl)aniline |
| N-(3-amino-benzyl)-phthalimide |
| 3-(phthalimidomethyl)aniline |
| 3-N-Phthaloylglyaminomethyl aniline |
