Introduction:Basic information about CAS 49713-39-5|diethyl 2-[[4-(trifluoromethyl)anilino]methylidene]propanedioate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | diethyl 2-[[4-(trifluoromethyl)anilino]methylidene]propanedioate |
|---|
| CAS Number | 49713-39-5 | Molecular Weight | 331.28700 |
|---|
| Density | 1.282g/cm3 | Boiling Point | 343.9ºC at 760 mmHg |
|---|
| Molecular Formula | C15H16F3NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 161.8ºC |
|---|
Names
| Name | diethyl 2-[[4-(trifluoromethyl)anilino]methylidene]propanedioate |
|---|
Chemical & Physical Properties
| Density | 1.282g/cm3 |
|---|
| Boiling Point | 343.9ºC at 760 mmHg |
|---|
| Molecular Formula | C15H16F3NO4 |
|---|
| Molecular Weight | 331.28700 |
|---|
| Flash Point | 161.8ºC |
|---|
| Exact Mass | 331.10300 |
|---|
| PSA | 64.63000 |
|---|
| LogP | 3.20040 |
|---|
| Index of Refraction | 1.505 |
|---|
| InChIKey | JJXDEKZGHIXHPA-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(=CNc1ccc(C(F)(F)F)cc1)C(=O)OCC |
|---|