Introduction：Basic information about CAS 6328-00-3|Benzenebutanoic acid,3-nitro-g-oxo-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenebutanoic acid,3-nitro-g-oxo- |
|---|
| CAS Number | 6328-00-3 | Molecular Weight | 223.18200 |
|---|
| Density | 1.391g/cm3 | Boiling Point | 404.1ºC at 760 mmHg |
|---|
| Molecular Formula | C10H9NO5 | Melting Point | 165-166ºC |
|---|
| MSDS | / | Flash Point | 176.8ºC |
|---|
Names
| Name | 4-(3-nitrophenyl)-4-oxobutanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.391g/cm3 |
|---|
| Boiling Point | 404.1ºC at 760 mmHg |
|---|
| Melting Point | 165-166ºC |
|---|
| Molecular Formula | C10H9NO5 |
|---|
| Molecular Weight | 223.18200 |
|---|
| Flash Point | 176.8ºC |
|---|
| Exact Mass | 223.04800 |
|---|
| PSA | 100.19000 |
|---|
| LogP | 2.16550 |
|---|
| Index of Refraction | 1.583 |
|---|
| InChIKey | VNDVLOPITGDGOG-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CCC(=O)c1cccc([N+](=O)[O-])c1 |
|---|
Safety Information
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 4-oxo-4-(3'-nitrophenyl)butanoic acid |
| 3-(m-Nitrobenzoyl)propionic acid |
| Propionic acid,3-(m-nitrobenzoyl) |
| 3-nitro-|A-oxo-benzenebutanoic acid |
| 4-oxo-4-(3-nitrophenyl)-butyric acid |
| 4-(3-Nitro-phenyl)-4-oxo-butyric acid |
| 3-(3-nitrobenzoyl)propionic acid |
