Introduction：Basic information about CAS 58749-23-8|Licochalcone B, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Licochalcone B |
|---|
| CAS Number | 58749-23-8 | Molecular Weight | 286.279 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 550.5±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H14O5 | Melting Point | 196-197ºC |
|---|
| MSDS | / | Flash Point | 208.5±23.6 °C |
|---|
Names
| Name | (E)-3-(3,4-dihydroxy-2-methoxyphenyl)-1-(4-hydroxyphenyl)prop-2-en-1-one |
|---|
| Synonym | More Synonyms |
|---|
Licochalcone B BiologicalActivity
| Description | Licochalcone B is an extract from the root of Glycyrrhiza inflate. Licochalcone B inhibits amyloid β (Aβ42) self-aggregation (IC50=2.16 μM) and disaggregate pre-formed Aβ42 fibrils, reduce metal-induced Aβ42 aggregation through chelating metal ions[1]. |
|---|
| References | [1]. Cao Y, et al. Licochalcone B, a chalcone derivative from Glycyrrhiza inflata, as a multifunctional agent for the treatment of Alzheimer's disease. Nat Prod Res. 2018 Oct 22:1-4. |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 550.5±50.0 °C at 760 mmHg |
|---|
| Melting Point | 196-197ºC |
|---|
| Molecular Formula | C16H14O5 |
|---|
| Molecular Weight | 286.279 |
|---|
| Flash Point | 208.5±23.6 °C |
|---|
| Exact Mass | 286.084137 |
|---|
| PSA | 86.99000 |
|---|
| LogP | 2.57 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.684 |
|---|
| InChIKey | DRDRYGIIYOPBBZ-XBXARRHUSA-N |
|---|
| SMILES | COc1c(C=CC(=O)c2ccc(O)cc2)ccc(O)c1O |
|---|
| Storage condition | 2-8C |
|---|
Synonyms
| 2-methoxy-3,4,4'-trihydroxychalcone |
| Licochalcone B |
| Licochalcon B |
| (2E)-3-(3,4-Dihydroxy-2-methoxyphenyl)-1-(4-hydroxyphenyl)-2-propen-1-one |
| 2-Propen-1-one, 3-(3,4-dihydroxy-2-methoxyphenyl)-1-(4-hydroxyphenyl)-, (2E)- |
| licochalcone |
