Introduction：Basic information about CAS 77633-03-5|2,4,6-Cycloheptatrien-1-one,3-[3-(3,4-dimethoxyphenyl)-1-oxo-2-propen-1-yl]-2-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4,6-Cycloheptatrien-1-one,3-[3-(3,4-dimethoxyphenyl)-1-oxo-2-propen-1-yl]-2-hydroxy- |
|---|
| CAS Number | 77633-03-5 | Molecular Weight | 312.31700 |
|---|
| Density | 1.292g/cm3 | Boiling Point | 496.7ºC at 760mmHg |
|---|
| Molecular Formula | C18H16O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 180.5ºC |
|---|
Names
| Name | 3-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-2-hydroxycyclohepta-2,4,6-trien-1-one |
|---|
Chemical & Physical Properties
| Density | 1.292g/cm3 |
|---|
| Boiling Point | 496.7ºC at 760mmHg |
|---|
| Molecular Formula | C18H16O5 |
|---|
| Molecular Weight | 312.31700 |
|---|
| Flash Point | 180.5ºC |
|---|
| Exact Mass | 312.10000 |
|---|
| PSA | 72.83000 |
|---|
| LogP | 2.66570 |
|---|
| Index of Refraction | 1.631 |
|---|
| InChIKey | AHRWGLYIEPGSTD-VQHVLOKHSA-N |
|---|
| SMILES | COc1ccc(C=CC(=O)c2ccccc(=O)c2O)cc1OC |
|---|
