Introduction：Basic information about CAS 4743-17-3|5-Chloroisatonic anhydride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Chloroisatonic anhydride |
|---|
| CAS Number | 4743-17-3 | Molecular Weight | 197.575 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C8H4ClNO3 | Melting Point | 300ºC (dec.) |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 5-Chloroisatoic Anhydride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Melting Point | 300ºC (dec.) |
|---|
| Molecular Formula | C8H4ClNO3 |
|---|
| Molecular Weight | 197.575 |
|---|
| Exact Mass | 196.987976 |
|---|
| PSA | 63.07000 |
|---|
| LogP | 1.50 |
|---|
| Index of Refraction | 1.601 |
|---|
| InChIKey | MYQFJMYJVJRSGP-UHFFFAOYSA-N |
|---|
| SMILES | O=c1[nH]c2ccc(Cl)cc2c(=O)o1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 6-CHLOROINDOLE-2,3-DIONE |
| 6-Chlor-benz[e][1,3]oxazin-2,4-dion |
| 6-chloro-benzo[e][1,3]oxazine-2,4-dione |
| 2H-1,3-Benzoxazine-2,4(3H)-dione,6-chloro |
| 6-Chloroisatin anhydride |
| BUTTPARK 50 7-92 |
| 2H-3,1-Benzoxazine-2,4(1H)-dione, 6-chloro- |
| 6-Chloro-1,2-dihydro -4H-3,1-benzoxazine-2,4-dione |
| 6-chloro-2H-1,3-benzoxazine-2,4(3H)-dione |
| 6-chloro-carsalam |
| 6-Chloro isatinic anhydride |
| 6-chloro-benz[e][1,3]oxazine-2,4-dione |
| 6-Chlor-1,3-benzoxazin-dion-(2,4) |
| 6-Chloro-1H-benzo[d][1,3]oxazine-2,4-dione |
| EINECS 225-255-7 |
| 6-CHLORO-2,3-INDOLINEDIONE |
| 6-chloro-1H-3,1-benzoxazine-2,4-dione |
| 5-Chloroisatonic anhydride |
| MFCD00006701 |
| 6-Chloro-2H-3,1-benzoxazine-2,4(1H)-dione |
| 5-Chloroisatoic anhydride |
