Introduction:Basic information about CAS 77400-65-8|Asocainol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Asocainol |
|---|
| CAS Number | 77400-65-8 | Molecular Weight | 417.54000 |
|---|
| Density | 1.113g/cm3 | Boiling Point | 597.1ºC at 760 mmHg |
|---|
| Molecular Formula | C27H31NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 314.9ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.113g/cm3 |
|---|
| Boiling Point | 597.1ºC at 760 mmHg |
|---|
| Molecular Formula | C27H31NO3 |
|---|
| Molecular Weight | 417.54000 |
|---|
| Flash Point | 314.9ºC |
|---|
| Exact Mass | 417.23000 |
|---|
| PSA | 41.93000 |
|---|
| LogP | 5.04610 |
|---|
| Index of Refraction | 1.58 |
|---|
| InChIKey | IORHSKBXWWSQME-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc2c(c1)-c1c(ccc(OC)c1O)CC(CCc1ccccc1)N(C)CC2 |
|---|