Introduction:Basic information about CAS 52935-96-3|METHYL 4-ALLYL-3 5-DIOXO-1-CYCLOHEXANE-&, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | METHYL 4-ALLYL-3 5-DIOXO-1-CYCLOHEXANE-& |
|---|
| CAS Number | 52935-96-3 | Molecular Weight | 210.22600 |
|---|
| Density | 1.128g/cm3 | Boiling Point | 316.9ºC at 760 mmHg |
|---|
| Molecular Formula | C11H14O4 | Melting Point | 128-132ºC(lit.) |
|---|
| MSDS | / | Flash Point | 138.5ºC |
|---|
Names
| Name | methyl 3,5-dioxo-4-prop-2-enylcyclohexane-1-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.128g/cm3 |
|---|
| Boiling Point | 316.9ºC at 760 mmHg |
|---|
| Melting Point | 128-132ºC(lit.) |
|---|
| Molecular Formula | C11H14O4 |
|---|
| Molecular Weight | 210.22600 |
|---|
| Flash Point | 138.5ºC |
|---|
| Exact Mass | 210.08900 |
|---|
| PSA | 60.44000 |
|---|
| LogP | 0.89990 |
|---|
| Index of Refraction | 1.476 |
|---|
| InChIKey | AJRVHWIHRHVDBE-UHFFFAOYSA-N |
|---|
| SMILES | C=CCC1C(=O)CC(C(=O)OC)CC1=O |
|---|
Safety Information
| WGK Germany | 3 |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| methyl 4-(2-propenyl)-3,5-cyclohexanedione carboxylate |
| Methyl 4-Allyl-3,5-Dioxo-1-Cyclohexanecarboxylate |
| MFCD00010808 |