Introduction：Basic information about CAS 183322-21-6|4-Chloro-6,7-bis-(2-chloroethoxy)quinazoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Chloro-6,7-bis-(2-chloroethoxy)quinazoline |
|---|
| CAS Number | 183322-21-6 | Molecular Weight | 321.58700 |
|---|
| Density | 1.424g/cm3 | Boiling Point | 455.8ºC at 760 mmHg |
|---|
| Molecular Formula | C12H11Cl3N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 229.5ºC |
|---|
Names
| Name | 4-chloro-6,7-bis(2-chloroethoxy)quinazoline |
|---|
Chemical & Physical Properties
| Density | 1.424g/cm3 |
|---|
| Boiling Point | 455.8ºC at 760 mmHg |
|---|
| Molecular Formula | C12H11Cl3N2O2 |
|---|
| Molecular Weight | 321.58700 |
|---|
| Flash Point | 229.5ºC |
|---|
| Exact Mass | 319.98900 |
|---|
| PSA | 44.24000 |
|---|
| LogP | 3.51840 |
|---|
| Vapour Pressure | 4.61E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.602 |
|---|
| InChIKey | WXAZLCUYDRYLFC-UHFFFAOYSA-N |
|---|
| SMILES | ClCCOc1cc2ncnc(Cl)c2cc1OCCCl |
|---|
