Introduction:Basic information about CAS 97776-05-1|4-amino-3-bromo-5-(trifluoromethyl)benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-amino-3-bromo-5-(trifluoromethyl)benzoic acid |
|---|
| CAS Number | 97776-05-1 | Molecular Weight | 284.03000 |
|---|
| Density | 1.845g/cm3 | Boiling Point | 333.9ºC at 760 mmHg |
|---|
| Molecular Formula | C8H5BrF3NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 155.7ºC |
|---|
Names
| Name | 4-amino-3-bromo-5-(trifluoromethyl)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.845g/cm3 |
|---|
| Boiling Point | 333.9ºC at 760 mmHg |
|---|
| Molecular Formula | C8H5BrF3NO2 |
|---|
| Molecular Weight | 284.03000 |
|---|
| Flash Point | 155.7ºC |
|---|
| Exact Mass | 282.94600 |
|---|
| PSA | 63.32000 |
|---|
| LogP | 3.32950 |
|---|
| Index of Refraction | 1.564 |
|---|
| InChIKey | FJSVZFGLPVHCGT-UHFFFAOYSA-N |
|---|
| SMILES | Nc1c(Br)cc(C(=O)O)cc1C(F)(F)F |
|---|
Synonyms
| Benzoic acid,4-amino-3-bromo-5-(trifluoromethyl) |
| 4-amino-3-bromo-5-trifluoromethyl-benzoic acid |