Introduction：Basic information about CAS 33584-60-0|2-aminoindan-2-carboxylic acid hydrochloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-aminoindan-2-carboxylic acid hydrochloride |
|---|
| CAS Number | 33584-60-0 | Molecular Weight | 213.661 |
|---|
| Density | 1.295g/cm3 | Boiling Point | 357.1ºC at 760mmHg |
|---|
| Molecular Formula | C10H12ClNO2 | Melting Point | 251-256ºC |
|---|
| MSDS | / | Flash Point | 169.8ºC |
|---|
Names
| Name | 2-aminoindan-2-carboxylic acid hydrochloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.295g/cm3 |
|---|
| Boiling Point | 357.1ºC at 760mmHg |
|---|
| Melting Point | 251-256ºC |
|---|
| Molecular Formula | C10H12ClNO2 |
|---|
| Molecular Weight | 213.661 |
|---|
| Flash Point | 169.8ºC |
|---|
| Exact Mass | 213.055649 |
|---|
| PSA | 63.32000 |
|---|
| LogP | 2.06960 |
|---|
| InChIKey | TUBGNZQKMUMUEA-UHFFFAOYSA-N |
|---|
| SMILES | Cl.NC1(C(=O)O)Cc2ccccc2C1 |
|---|
Safety Information
| Safety Phrases | S24/25 |
|---|
| HS Code | 2922499990 |
|---|
Customs
| HS Code | 2922499990 |
|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2-Aminoindal-2-Carboxylic acid HCl |
| 2-Aminoindane-2-carboxylic acid HCl |
| 2-Amino-2-indanecarboxylic acid hydrochloride (1:1) |
| 2-Aminoindan-2-carboxylic acid hydrochloride |
| H-Aic-OH.HCl |
| DL-2-AMINO-1,3-DIHYDROPHENALENE-2-CARBOXYLIC ACID HYDROCHLORIDE |
| 2-amino-2,3-dihydro-,hydrochloride |
| 2-Aminoindane-2-carboxylicacid hydrochloride |
| H-Aic-OH,HCl |
| 1H-Indene-2-carboxylic acid, 2-amino-2,3-dihydro-, hydrochloride (1:1) |
