Introduction：Basic information about CAS 34883-39-1|2,5-dichlorobiphenyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,5-dichlorobiphenyl |
|---|
| CAS Number | 34883-39-1 | Molecular Weight | 223.09800 |
|---|
| Density | 1.249 g/cm3 | Boiling Point | 303.5ºC at 760 mmHg |
|---|
| Molecular Formula | C12H8Cl2 | Melting Point | 22.5°C |
|---|
| MSDS | / | Flash Point | 133.7ºC |
|---|
Names
| Name | 2,5-dichlorobiphenyl |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.249 g/cm3 |
|---|
| Boiling Point | 303.5ºC at 760 mmHg |
|---|
| Melting Point | 22.5°C |
|---|
| Molecular Formula | C12H8Cl2 |
|---|
| Molecular Weight | 223.09800 |
|---|
| Flash Point | 133.7ºC |
|---|
| Exact Mass | 222.00000 |
|---|
| LogP | 4.66040 |
|---|
| Index of Refraction | 1.594 |
|---|
| InChIKey | KKQWHYGECTYFIA-UHFFFAOYSA-N |
|---|
| SMILES | Clc1ccc(Cl)c(-c2ccccc2)c1 |
|---|
Safety Information
| Hazard Codes | N: Dangerous for the environment; |
|---|
| Risk Phrases | R33 |
|---|
| Safety Phrases | 35-60-61 |
|---|
| RIDADR | UN 2315 |
|---|
| Packaging Group | II |
|---|
Synonyms
| 2,5-chlorobiphenyl |
| 2,4-DIOXO-1,2,3,4-TETRAHYDROPYRIMIDINE-5-SULFONYL CHLORIDE |
| 1,4-dichloro-2-phenylbenzene |
| 2,5-Dichlor-biphenyl |
| 2,5-Dichloro-1,1'-biphenyl |
| 3,6-Dichlorobiphenyl |
| 1,1'-Biphenyl,2,5-dichloro |
| 2,5-dichloro-biphenyl |
