Introduction：Basic information about CAS 18259-05-7|2,3,4,5,6-PCB, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,3,4,5,6-PCB |
|---|
| CAS Number | 18259-05-7 | Molecular Weight | 326.433 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 371.4±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H5Cl5 | Melting Point | 123.5°C |
|---|
| MSDS | / | Flash Point | 178.1±23.9 °C |
|---|
Names
| Name | 2,3,4,5,6-pentachlorobiphenyl |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 371.4±37.0 °C at 760 mmHg |
|---|
| Melting Point | 123.5°C |
|---|
| Molecular Formula | C12H5Cl5 |
|---|
| Molecular Weight | 326.433 |
|---|
| Flash Point | 178.1±23.9 °C |
|---|
| Exact Mass | 323.883392 |
|---|
| LogP | 6.04 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.620 |
|---|
| InChIKey | GGMPTLAAIUQMIE-UHFFFAOYSA-N |
|---|
| SMILES | Clc1c(Cl)c(Cl)c(-c2ccccc2)c(Cl)c1Cl |
|---|
Safety Information
Customs
| HS Code | 2903999010 |
|---|
| Summary | 2903999010 2,3,3',4,5,6-hexachloro-1,1'-biphenyl。supervision conditions:89(articles on the list of prohibited export goods,articles on the list of prohibited import goods)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:5.5%。general tariff:30.0% |
|---|
Synonyms
| 2,3,4,5,6-PCB |
| Biphenyl,pentachloro |
| Apirolio 1476 C |
| PENTACHLOROBIPHENYL |
| Pentachlorodiphenyl |
| perchlorobiphenyl |
| 1,1'-Biphenyl,2,3,4,5,6-pentachloro |
| 1,2,3,4,5-pentachloro-6-phenylbenzene |
| 2,3,4,5,6-Pentachlor-biphenyl |
| Pyralene 1476 |
| 2,3,4,5,6-Pentachlorobiphenyl |
| Diphenyl pentachloride |
| 2,3,4,5,6-Pentachlor-diphenyl |
| Kanekrol 500 |
| 1,1'-Biphenyl, 2,3,4,5,6-pentachloro- |
| Pyroclor 5 |
