Introduction：Basic information about CAS 6313-17-3|Benzoic acid,3-iodo-5-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzoic acid,3-iodo-5-nitro- |
|---|
| CAS Number | 6313-17-3 | Molecular Weight | 293.01500 |
|---|
| Density | 2.156g/cm3 | Boiling Point | 410ºC at 760 mmHg |
|---|
| Molecular Formula | C7H4INO4 | Melting Point | 166-170 °C |
|---|
| MSDS | / | Flash Point | 201.8ºC |
|---|
Names
| Name | 3-iodo-5-nitrobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.156g/cm3 |
|---|
| Boiling Point | 410ºC at 760 mmHg |
|---|
| Melting Point | 166-170 °C |
|---|
| Molecular Formula | C7H4INO4 |
|---|
| Molecular Weight | 293.01500 |
|---|
| Flash Point | 201.8ºC |
|---|
| Exact Mass | 292.91900 |
|---|
| PSA | 83.12000 |
|---|
| LogP | 2.42080 |
|---|
| Index of Refraction | 1.702 |
|---|
| InChIKey | GFGURBBHVJTXDU-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc(I)cc([N+](=O)[O-])c1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 22-50 |
|---|
| RIDADR | UN 3077 9 / PGIII |
|---|
Synonyms
| 3-nitro-5-iodobenzoic acid |
| 3-Carboxy-5-iodonitrobenzene |
| iodonitrobenzoicacid |
| 3-Jod-5-nitro-benzoesaeure |
| 3-iodo 5-nitro benzoic acid |
| Benzoic acid,3-iodo-5-nitro |
