Introduction:Basic information about CAS 6406-53-7|Solvent Red 32, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Solvent Red 32 |
|---|
| CAS Number | 6406-53-7 | Molecular Weight | 165.232 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 258.2±15.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H15NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 107.5±13.6 °C |
|---|
Names
| Name | Solvent Red 32 |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 258.2±15.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H15NO |
|---|
| Molecular Weight | 165.232 |
|---|
| Flash Point | 107.5±13.6 °C |
|---|
| Exact Mass | 165.115356 |
|---|
| PSA | 207.20000 |
|---|
| LogP | 1.72 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.519 |
|---|
| InChIKey | YKDUQSBJQCVFSC-UHFFFAOYSA-N |
|---|
| SMILES | C1CCC(NC2CCCCC2)CC1.Cc1ccccc1N=Nc1ccc(N=Nc2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)ccc3c2O)c(C)c1 |
|---|
Synonyms
| 2-(4-Methoxyphenyl)-1-methylethylamine |
| (±)-4-Methoxyamphetamine |
| (±)-1-(p-Methoxyphenyl)-2-aminopropane |
| 1-(4-Methoxyphenyl)propan-2-amine |
| (±)-p-Methoxyamphetamine |
| DL-p-Methoxy-α-methylphenethylamine |
| UNII:OVB8F8P39Q |
| (d,l)-4-Methoxyamphetamine |
| α-Methyl-β-(p-methoxyphenyl)ethylamine |
| 1-(4-Methoxyphenyl)-2-propanamine |
| p-methoxyamphetamine |
| 4-Hydroxy-3-[2-[2-methyl-4-[2-(2-methylphenyl)diazenyl]phenyl]diazenyl]-2,7-naphthalenedisulfonic acid N-cyclohexylcyclohexanamine |
| p-Methoxy-α-methylphenethylamine |
| para-Methoxyamphetamine |
| Phenethylamine, p-methoxy-α-methyl- |
| Benzeneethanamine, 4-methoxy-α-methyl- |
| 1-(4-methoxyphenyl)propan-2-amine hydrochloride |
| 4-Methoxy-α-methylbenzeneethanamine |
| C.I.26766 |