Introduction：Basic information about CAS 629643-27-2|Gnetucleistol E, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Gnetucleistol E |
|---|
| CAS Number | 629643-27-2 | Molecular Weight | 272.296 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 467.3±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H16O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 236.4±25.9 °C |
|---|
Names
| Name | 5-[2-(3,4-dimethoxyphenyl)ethenyl]benzene-1,3-diol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 467.3±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H16O4 |
|---|
| Molecular Weight | 272.296 |
|---|
| Flash Point | 236.4±25.9 °C |
|---|
| Exact Mass | 272.104858 |
|---|
| PSA | 58.92000 |
|---|
| LogP | 3.50 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.665 |
|---|
| InChIKey | WHKSEHKYYXHCTA-ONEGZZNKSA-N |
|---|
| SMILES | COc1ccc(C=Cc2cc(O)cc(O)c2)cc1OC |
|---|
Synonyms
| 5-[(1E)-2-(3,4-dimethoxyphenyl)ethenyl]-1,3-Benzenediol |
| 3-methoxy-isorhapontigenin |
| Gnetucleistol E |
| 1,3-Benzenediol, 5-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]- |
| 5-[(E)-2-(3,4-Dimethoxyphenyl)vinyl]-1,3-benzenediol |
| 1,3-Benzenediol,5-[(1E)-2-(3,4-dimethoxyphenyl)ethenyl] |
