Introduction：Basic information about CAS 331443-00-6|3,4,5,4'-tetrahydroxystilbene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,4,5,4'-tetrahydroxystilbene |
|---|
| CAS Number | 331443-00-6 | Molecular Weight | 244.243 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 507.8±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H12O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 252.4±24.7 °C |
|---|
Names
| Name | 5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,2,3-triol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 507.8±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H12O4 |
|---|
| Molecular Weight | 244.243 |
|---|
| Flash Point | 252.4±24.7 °C |
|---|
| Exact Mass | 244.073563 |
|---|
| PSA | 80.92000 |
|---|
| LogP | 2.87 |
|---|
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.801 |
|---|
| InChIKey | GRZOJEWQFCAKPF-OWOJBTEDSA-N |
|---|
| SMILES | Oc1ccc(C=Cc2cc(O)c(O)c(O)c2)cc1 |
|---|
Synonyms
| 3,4,5,4'-tetrahydroxystilbene |
| 1,2,3-Benzenetriol, 5-[(E)-2-(4-hydroxyphenyl)ethenyl]- |
| 5-[(E)-2-(4-Hydroxyphenyl)vinyl]-1,2,3-benzenetriol |
| 4-HydroxyResveratrol |
