Introduction:Basic information about CAS 97-09-6|3-Nitro-4-chlorobenzenesulfonamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Nitro-4-chlorobenzenesulfonamide |
|---|
| CAS Number | 97-09-6 | Molecular Weight | 236.633 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 427.9±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H5ClN2O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 212.6±31.5 °C |
|---|
Names
| Name | 4-Chloro-3-nitrobenzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 427.9±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H5ClN2O4S |
|---|
| Molecular Weight | 236.633 |
|---|
| Flash Point | 212.6±31.5 °C |
|---|
| Exact Mass | 235.965851 |
|---|
| PSA | 114.36000 |
|---|
| LogP | 0.86 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.622 |
|---|
| InChIKey | SPZGXONNVLTQDE-UHFFFAOYSA-N |
|---|
| SMILES | NS(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| HS Code | 2935009090 |
|---|
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| 4-Chloro-3-nitrobenzenesulfonamide |
| 4-Chlor-3-nitro-benzolsulfonsaeure-amid |
| EINECS 202-559-8 |
| 4-chloro-3-nitrobenzene-1-sulfonamide |
| 4-Chloro-3-nitrobenzenesulphonamide |
| MFCD00035783 |
| Benzenesulfonamide, 4-chloro-3-nitro- |
| 4-chloro-3-nitro-benzenesulfonic acid amide |
| 4-chloro-3-nitrophenyl-sulfonamide |
| 3-Nitro-4-chlorobenzenesulfonamide |
| 4'-chloro-3'-nitrobenzenesulfonamide |
| Benzenesulfonamide,4-chloro-3-nitro |