Introduction：Basic information about CAS 1825-23-6|pentachlorobenzoyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | pentachlorobenzoyl chloride |
|---|
| CAS Number | 1825-23-6 | Molecular Weight | 312.79200 |
|---|
| Density | 1.781 g/cm3 | Boiling Point | 335.4ºC at 760 mmHg |
|---|
| Molecular Formula | C7Cl6O | Melting Point | 83-85ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2,3,4,5,6-pentachlorobenzoyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.781 g/cm3 |
|---|
| Boiling Point | 335.4ºC at 760 mmHg |
|---|
| Melting Point | 83-85ºC |
|---|
| Molecular Formula | C7Cl6O |
|---|
| Molecular Weight | 312.79200 |
|---|
| Exact Mass | 309.80800 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 5.33260 |
|---|
| InChIKey | AAUSLOKBERXEER-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| T0500-2251 |
| benzoyl perchloride |
| Pentachlorbenzoesaeurechlorid |
| perchlorobenzoylchloride |
| Pentachlor-benzoylchlorid |
| pentachloro-benzoyl chloride |
