Introduction：Basic information about CAS 88-22-2|2,4-Dimethylaniline-6-sulfonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4-Dimethylaniline-6-sulfonic acid |
|---|
| CAS Number | 88-22-2 | Molecular Weight | 201.243 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C8H11NO3S | Melting Point | 146-149 °C(lit.) |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
| Name | 2,4-Dimethylaniline-6-sulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Melting Point | 146-149 °C(lit.) |
|---|
| Molecular Formula | C8H11NO3S |
|---|
| Molecular Weight | 201.243 |
|---|
| Exact Mass | 201.045959 |
|---|
| PSA | 88.77000 |
|---|
| LogP | 1.01 |
|---|
| Index of Refraction | 1.595 |
|---|
| InChIKey | CFCXQQUQLZIZPI-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C)c(N)c(S(=O)(=O)O)c1 |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| HS Code | 2921430090 |
|---|
Customs
| HS Code | 2921430090 |
|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2,4-Dimethylaniline-6-sulfonic acid |
| Benzenesulfonic acid, 2-amino-3,5-dimethyl- |
| EINECS 201-811-4 |
| MFCD00035770 |
| 2-Amino-3,5-dimethylbenzenesulfonic acid |
