Introduction：Basic information about CAS 97-06-3|Benzenesulfonic acid,4-methyl-3-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenesulfonic acid,4-methyl-3-nitro- |
|---|
| CAS Number | 97-06-3 | Molecular Weight | 217.19900 |
|---|
| Density | 1.547g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C7H7NO5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-methyl-3-nitrobenzenesulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.547g/cm3 |
|---|
| Molecular Formula | C7H7NO5S |
|---|
| Molecular Weight | 217.19900 |
|---|
| Exact Mass | 217.00400 |
|---|
| PSA | 108.57000 |
|---|
| LogP | 2.75390 |
|---|
| Index of Refraction | 1.596 |
|---|
| InChIKey | GJYYWZTYFNSZRP-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)O)cc1[N+](=O)[O-] |
|---|
Safety Information
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 2-nitro-toluene-4-sulfonic acid |
| 2-nitro-p-toluenesulfonic acid |
| 2-Nitro-toluol-sulfonsaeure-(4) |
| 2-Nitro-p-toluenesulphonic acid |
| 4-Methyl-3-nitrobenzensulfonic acid |
| 2-Nitro-toluol-4-sulfonsaeure |
| EINECS 202-556-1 |
| 4-methyl-3-nitro-benzenesulfonic acid |
