Introduction:Basic information about CAS 10081-67-1|Bis[4-(2-phenyl-2-propyl)phenyl]amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Bis[4-(2-phenyl-2-propyl)phenyl]amine |
|---|
| CAS Number | 10081-67-1 | Molecular Weight | 405.574 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 535.2±39.0 °C at 760 mmHg |
|---|
| Molecular Formula | C30H31N | Melting Point | 100°C |
|---|
| MSDS | USA | Flash Point | 292.0±22.5 °C |
|---|
Names
| Name | Naugard 445 |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 535.2±39.0 °C at 760 mmHg |
|---|
| Melting Point | 100°C |
|---|
| Molecular Formula | C30H31N |
|---|
| Molecular Weight | 405.574 |
|---|
| Flash Point | 292.0±22.5 °C |
|---|
| Exact Mass | 405.245636 |
|---|
| PSA | 12.03000 |
|---|
| LogP | 8.34 |
|---|
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.607 |
|---|
| InChIKey | UJAWGGOCYUPCPS-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(c1ccccc1)c1ccc(Nc2ccc(C(C)(C)c3ccccc3)cc2)cc1 |
|---|
Safety Information
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| HS Code | 2921499090 |
|---|
Customs
| HS Code | 2921499090 |
|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 4-(2-phenylpropan-2-yl)-n-[4-(2-phenylpropan-2-yl)phenyl]aniline |
| Benzenamine, 4-(1-methyl-1-phenylethyl)-N-(4-(1-methyl-1-phenylethyl)phenyl)- |
| Bis[4-(2-phenyl-2-propyl)phenyl]amine |
| Benzenamine, 4-(1-methyl-1-phenylethyl)-N-[4-(1-methyl-1-phenylethyl)phenyl]- |
| 4,4'-bis(alpha,alpha-Dimethylbenzyl)diphenylamine |
| MFCD00337918 |
| 4-(1-Methyl-1-phenylethyl)-N-(4-(1-methyl-1-phenylethyl)phenyl)aniline |
| 4,4'-Bis(α,α-dimethylbenzyl)diphenylamine |
| 4-(2-Phenyl-2-propanyl)-N-[4-(2-phenyl-2-propanyl)phenyl]aniline |
| EINECS 233-215-5 |