Introduction：Basic information about CAS 18264-71-6|bis(2-nitrophenyl)amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | bis(2-nitrophenyl)amine |
|---|
| CAS Number | 18264-71-6 | Molecular Weight | 259.218 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 406.0±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H9N3O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 199.3±24.6 °C |
|---|
Names
| Name | 2,2'-Dinitrodiphenylamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 406.0±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H9N3O4 |
|---|
| Molecular Weight | 259.218 |
|---|
| Flash Point | 199.3±24.6 °C |
|---|
| Exact Mass | 259.059296 |
|---|
| PSA | 103.67000 |
|---|
| LogP | 3.83 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.693 |
|---|
| InChIKey | RENCFAVKFWOLJJ-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccccc1Nc1ccccc1[N+](=O)[O-] |
|---|
Safety Information
Customs
| HS Code | 2921499090 |
|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2.2'-Dinitro-diphenylamin |
| Bis-(2-nitro-phenyl)-amin |
| Benzenamine, 2-nitro-N-(2-nitrophenyl)- |
| N-(2-Nitrophenyl)-2-nitroaniline |
| HN(o-PhNO2)2 |
| 2-Nitro-N-(2-nitrophenyl)aniline |
| 2,10-DODECADIYNE |
| bis(2-nitrophenyl)amine |
| bis-(2-nitro-phenyl)-amine |
| Benzenamine, 2-nitro-N- (2-nitrophenyl)- |
| di(o-nitrophenyl)amine |
