Introduction：Basic information about CAS 4993-93-5|Ethyl 4-Nitroindole-2-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 4-Nitroindole-2-carboxylate |
|---|
| CAS Number | 4993-93-5 | Molecular Weight | 234.208 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 429.5±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H10N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 213.5±23.2 °C |
|---|
Names
| Name | ethyl 4-nitro-1h-indole-2-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 429.5±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H10N2O4 |
|---|
| Molecular Weight | 234.208 |
|---|
| Flash Point | 213.5±23.2 °C |
|---|
| Exact Mass | 234.064056 |
|---|
| PSA | 87.91000 |
|---|
| LogP | 2.83 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.652 |
|---|
| InChIKey | LXUABEANNNKOLF-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc2c([N+](=O)[O-])cccc2[nH]1 |
|---|
| Storage condition | 2-8°C |
|---|
Synonyms
| ethyl 4-nitro-1 H-indole-2-carboxylate |
| ethyl 5-nitroindole-2-carboxylate |
| 4-Nitro-indol-2-carbonsaeure-aethylester |
| 4-nitro-indole-2-carboxylic acid ethyl ester |
| Ethyl 4-nitro-1H-indole-2-carboxylate |
| 1H-Indole-2-carboxylic acid, 4-nitro-, ethyl ester |
| ethyl 4-nitroindole-2-carboxylate |
| 4-nitro-1H-indole-2-carboxylic acid ethyl ester |
